C21H19N5O2S — CID 1094854
N-(furan-2-ylmethyl)-2-[(4-prop-2-enyl-5-quinolin-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 1094854) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(4-prop-2-enyl-5-quinolin-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(4-prop-2-enyl-5-quinolin-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 1094854 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(4-prop-2-enyl-5-quinolin-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccco2)nnc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H19N5O2S/c1-2-11-26-20(18-10-9-15-6-3-4-8-17(15)23-18)24-25-21(26)29-14-19(27)22-13-16-7-5-12-28-16/h2-10,12H,1,11,13-14H2,(H,22,27) |
| InChIKey | PNNPDXTXHQHWMF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|