About 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide
2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485595) has the molecular formula C14H30IN3OS
and a molecular weight of 415.39 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| PubChem CID | 109485595 |
| Molecular Formula | C14H30IN3OS |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCOCC(C)C)CCS1.I |
| InChI | InChI=1S/C14H29N3OS.HI/c1-5-13-10-17(7-9-19-13)14(15-4)16-6-8-18-11-12(2)3;/h12-13H,5-11H2,1-4H3,(H,15,16);1H |
| InChIKey | AFRDYJXQTZGYFG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide?
The IUPAC name of 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide (CID 109485595) is 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
What is the SMILES notation for 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide?
The canonical SMILES for 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide is CCC1CN(/C(=N/C)NCCOCC(C)C)CCS1.I.
What is the InChIKey of 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide?
The InChIKey is AFRDYJXQTZGYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3OS.HI/c1-5-13-10-17(7-9-19-13)14(15-4)16-6-8-18-11-12(2)3;/h12-13H,5-11H2,1-4H3,(H,15,16);1H.
What are the key properties of 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide?
2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide has a molecular weight of 415.39 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N'-methyl-N-[2-(2-methylpropoxy)ethyl]thiomorpholine-4-carboximidamide;hydroiodide is sourced from PubChem (CID 109485595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).