C24H24FN5OS — CID 1094856
N-[(4-fluorophenyl)methyl]-2-[[5-[(2-methyl-1H-indol-3-yl)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 1094856) has the molecular formula C24H24FN5OS and a molecular weight of 449.56 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[[5-[(2-methyl-1H-indol-3-yl)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[[5-[(2-methyl-1H-indol-3-yl)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 1094856 |
| Molecular Formula | C24H24FN5OS |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[[5-[(2-methyl-1H-indol-3-yl)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(Cc2c(C)[nH]c3ccccc23)nnc1SCC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FN5OS/c1-3-12-30-22(13-20-16(2)27-21-7-5-4-6-19(20)21)28-29-24(30)32-15-23(31)26-14-17-8-10-18(25)11-9-17/h3-11,27H,1,12-15H2,2H3,(H,26,31) |
| InChIKey | DOICUNHUJXJPGU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|