C20H36O4Si — CID 10948619
[(4'S,4'aS,8'aR)-4'-[tert-butyl(dimethyl)silyl]oxy-4'a-methylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydronaphthalene]-1'-yl]methanol (PubChem CID 10948619) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is [(4'S,4'aS,8'aR)-4'-[tert-butyl(dimethyl)silyl]oxy-4'a-methylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydronaphthalene]-1'-yl]methanol.
| Compound Name | [(4'S,4'aS,8'aR)-4'-[tert-butyl(dimethyl)silyl]oxy-4'a-methylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydronaphthalene]-1'-yl]methanol |
|---|---|
| PubChem CID | 10948619 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | [(4'S,4'aS,8'aR)-4'-[tert-butyl(dimethyl)silyl]oxy-4'a-methylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydronaphthalene]-1'-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC=C(CO)[C@H]2CC3(CC[C@]12C)OCCO3 |
| InChI | InChI=1S/C20H36O4Si/c1-18(2,3)25(5,6)24-17-8-7-15(14-21)16-13-20(22-11-12-23-20)10-9-19(16,17)4/h7,16-17,21H,8-14H2,1-6H3/t16-,17+,19+/m1/s1 |
| InChIKey | KJPVAJUJMDDTDS-AOIWGVFYSA-N |
| XLogP | 4.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|