C18H28NO3PS — CID 10948643
2-[(2R,4R)-5,5-dimethyl-2-(2-phenylethyl)-1,3-thiazolidin-4-yl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 10948643) has the molecular formula C18H28NO3PS and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[(2R,4R)-5,5-dimethyl-2-(2-phenylethyl)-1,3-thiazolidin-4-yl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-[(2R,4R)-5,5-dimethyl-2-(2-phenylethyl)-1,3-thiazolidin-4-yl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 10948643 |
| Molecular Formula | C18H28NO3PS |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[(2R,4R)-5,5-dimethyl-2-(2-phenylethyl)-1,3-thiazolidin-4-yl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC1(C)COP(=O)([C@H]2N[C@@H](CCc3ccccc3)SC2(C)C)OC1 |
| InChI | InChI=1S/C18H28NO3PS/c1-17(2)12-21-23(20,22-13-17)16-18(3,4)24-15(19-16)11-10-14-8-6-5-7-9-14/h5-9,15-16,19H,10-13H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | RMSFFMCKHIPTAA-HZPDHXFCSA-N |
| XLogP | 4.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|