C15H17IO3 — CID 10948711
(3aR,4S,6R,6aR)-6-iodo-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 10948711) has the molecular formula C15H17IO3 and a molecular weight of 372.20 g/mol. Its IUPAC name is (3aR,4S,6R,6aR)-6-iodo-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,6R,6aR)-6-iodo-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10948711 |
| Molecular Formula | C15H17IO3 |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | (3aR,4S,6R,6aR)-6-iodo-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](COCc3ccccc3)C[C@@H](I)[C@@H]2O1 |
| InChI | InChI=1S/C15H17IO3/c16-13-6-11(12-7-14(17)19-15(12)13)9-18-8-10-4-2-1-3-5-10/h1-5,11-13,15H,6-9H2/t11-,12-,13-,15-/m1/s1 |
| InChIKey | COMNSXPQUPZXGD-RGCMKSIDSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|