C24H20O4 — CID 10948715
dimethyl (2R,5R,7S,10R,12S,15S,17R,20S)-undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosa-8,18-diene-1,6-dicarboxylate (PubChem CID 10948715) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is dimethyl (2R,5R,7S,10R,12S,15S,17R,20S)-undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosa-8,18-diene-1,6-dicarboxylate.
| Compound Name | dimethyl (2R,5R,7S,10R,12S,15S,17R,20S)-undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosa-8,18-diene-1,6-dicarboxylate |
|---|---|
| PubChem CID | 10948715 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | dimethyl (2R,5R,7S,10R,12S,15S,17R,20S)-undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosa-8,18-diene-1,6-dicarboxylate |
| SMILES | COC(=O)C12C3[C@@H]4C5=C6[C@H]7C4C4[C@H]8C9=C([C@@H]43)[C@@H]1C1C([C@@H]6C(C(=O)OC)(C87)[C@@H]91)[C@H]52 |
| InChI | InChI=1S/C24H20O4/c1-27-21(25)23-15-5-3-4-6(15)10-12-8(4)16-7(3)11-9(5)17(23)13-14(18(10)23)20(12)24(16,19(11)13)22(26)28-2/h3-8,13-20H,1-2H3/t3?,4?,5-,6+,7+,8-,13?,14?,15?,16?,17-,18+,19+,20-,23?,24? |
| InChIKey | CNSGMZAVSIRWHQ-KPXCRWEBSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|