C17H29NO8 — CID 10948785
tert-butyl (3aS,4R,6aR)-4-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 10948785) has the molecular formula C17H29NO8 and a molecular weight of 375.42 g/mol. Its IUPAC name is tert-butyl (3aS,4R,6aR)-4-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4R,6aR)-4-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 10948785 |
| Molecular Formula | C17H29NO8 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl (3aS,4R,6aR)-4-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | COC(=O)CC(O)C(O)[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO8/c1-16(2,3)26-15(22)18-8-10-14(25-17(4,5)24-10)12(18)13(21)9(19)7-11(20)23-6/h9-10,12-14,19,21H,7-8H2,1-6H3/t9?,10-,12-,13?,14-/m1/s1 |
| InChIKey | LMTNTUWEYUFOKK-WRAKUBOLSA-N |
| XLogP | 0.41 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |