About N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide
N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109487856) has the molecular formula C11H24IN3OS
and a molecular weight of 373.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
| PubChem CID | 109487856 |
| Molecular Formula | C11H24IN3OS |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCOC)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C11H23N3OS.HI/c1-11(2)9-14(6-8-16-11)10(12-3)13-5-7-15-4;/h5-9H2,1-4H3,(H,12,13);1H |
| InChIKey | JXJHCUPPGMJYIB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide?
The IUPAC name of N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide (CID 109487856) is N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide.
What is the SMILES notation for N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide?
The canonical SMILES for N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide is C/N=C(\NCCOC)N1CCSC(C)(C)C1.I.
What is the InChIKey of N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide?
The InChIKey is JXJHCUPPGMJYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3OS.HI/c1-11(2)9-14(6-8-16-11)10(12-3)13-5-7-15-4;/h5-9H2,1-4H3,(H,12,13);1H.
What are the key properties of N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide?
N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide has a molecular weight of 373.30 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide is sourced from PubChem (CID 109487856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).