C13H19F3N4S2 — CID 109488073
N',2,2-trimethyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 109488073) has the molecular formula C13H19F3N4S2 and a molecular weight of 352.45 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488073 |
| Molecular Formula | C13H19F3N4S2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N',2,2-trimethyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1nc(C(F)(F)F)cs1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C13H19F3N4S2/c1-12(2)8-20(4-5-22-12)11(17-3)18-6-10-19-9(7-21-10)13(14,15)16/h7H,4-6,8H2,1-3H3,(H,17,18) |
| InChIKey | TZFFXZTYSGBFLG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|