C15H24F3IN4S2 — CID 109488090
N-ethyl-2,2-dimethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488090) has the molecular formula C15H24F3IN4S2 and a molecular weight of 508.42 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488090 |
| Molecular Formula | C15H24F3IN4S2 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C15H23F3N4S2.HI/c1-4-19-13(22-7-8-24-14(2,3)10-22)20-6-5-12-21-11(9-23-12)15(16,17)18;/h9H,4-8,10H2,1-3H3,(H,19,20);1H |
| InChIKey | TZESAWVOJDWYQA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|