C23H24O3Si — CID 10948818
(2R,3S,4R)-2-[(R)-hydroxy(phenyl)methyl]-1,1-diphenylsilolane-3,4-diol (PubChem CID 10948818) has the molecular formula C23H24O3Si and a molecular weight of 376.53 g/mol. Its IUPAC name is (2R,3S,4R)-2-[(R)-hydroxy(phenyl)methyl]-1,1-diphenylsilolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-[(R)-hydroxy(phenyl)methyl]-1,1-diphenylsilolane-3,4-diol |
|---|---|
| PubChem CID | 10948818 |
| Molecular Formula | C23H24O3Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (2R,3S,4R)-2-[(R)-hydroxy(phenyl)methyl]-1,1-diphenylsilolane-3,4-diol |
| SMILES | O[C@@H]1[C@@H]([C@H](O)c2ccccc2)[Si](c2ccccc2)(c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C23H24O3Si/c24-20-16-27(18-12-6-2-7-13-18,19-14-8-3-9-15-19)23(22(20)26)21(25)17-10-4-1-5-11-17/h1-15,20-26H,16H2/t20-,21+,22-,23+/m0/s1 |
| InChIKey | IWYIKPJJTXDXTN-GSPCLOLRSA-N |
| XLogP | 2.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|