C17H24FN3S — CID 109488337
N-[2-(2-fluorophenyl)cyclopropyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109488337) has the molecular formula C17H24FN3S and a molecular weight of 321.46 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)cyclopropyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[2-(2-fluorophenyl)cyclopropyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488337 |
| Molecular Formula | C17H24FN3S |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[2-(2-fluorophenyl)cyclopropyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(/NC1CC1c1ccccc1F)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H24FN3S/c1-17(2)11-21(8-9-22-17)16(19-3)20-15-10-13(15)12-6-4-5-7-14(12)18/h4-7,13,15H,8-11H2,1-3H3,(H,19,20) |
| InChIKey | YQWFZVKOCJCEDF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|