C23H22O5 — CID 10948850
methyl (2R,3R)-2-[(15R)-15-methoxycarbonyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-3-methyloxirane-2-carboxylate (PubChem CID 10948850) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is methyl (2R,3R)-2-[(15R)-15-methoxycarbonyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-3-methyloxirane-2-carboxylate.
| Compound Name | methyl (2R,3R)-2-[(15R)-15-methoxycarbonyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-3-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 10948850 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | methyl (2R,3R)-2-[(15R)-15-methoxycarbonyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-3-methyloxirane-2-carboxylate |
| SMILES | COC(=O)[C@]1([C@@]2(C(=O)OC)O[C@@H]2C)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C23H22O5/c1-13-23(28-13,21(25)27-3)22(20(24)26-2)12-18-14-8-4-6-10-16(14)19(22)17-11-7-5-9-15(17)18/h4-11,13,18-19H,12H2,1-3H3/t13-,18?,19?,22+,23-/m1/s1 |
| InChIKey | HJFCAIXAOGNSBL-KFIMMIAQSA-N |
| XLogP | 3.16 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|