About [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate (PubChem CID 10948974) has the molecular formula C18H23BrO4
and a molecular weight of 383.28 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate.
Molecular Properties
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate |
| PubChem CID | 10948974 |
| Molecular Formula | C18H23BrO4 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)O[C@H]1C(=O)OCC1(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H23BrO4/c1-11(2)8-14(12-6-5-7-13(19)9-12)16(20)23-15-17(21)22-10-18(15,3)4/h5-7,9,11,14-15H,8,10H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | LHHKVVSSBMDARM-CABCVRRESA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate?
The IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate (CID 10948974) is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate.
What is the SMILES notation for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate?
The canonical SMILES for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate is CC(C)C[C@@H](C(=O)O[C@H]1C(=O)OCC1(C)C)c1cccc(Br)c1.
What is the InChIKey of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate?
The InChIKey is LHHKVVSSBMDARM-CABCVRRESA-N. The full InChI is InChI=1S/C18H23BrO4/c1-11(2)8-14(12-6-5-7-13(19)9-12)16(20)23-15-17(21)22-10-18(15,3)4/h5-7,9,11,14-15H,8,10H2,1-4H3/t14-,15+/m1/s1.
What are the key properties of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate?
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate has a molecular weight of 383.28 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-(3-bromophenyl)-4-methylpentanoate is sourced from PubChem (CID 10948974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).