C14H22F3IN4S2 — CID 109490032
N-ethyl-2,2-dimethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109490032) has the molecular formula C14H22F3IN4S2 and a molecular weight of 494.39 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490032 |
| Molecular Formula | C14H22F3IN4S2 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C14H21F3N4S2.HI/c1-4-18-12(21-5-6-23-13(2,3)9-21)19-7-11-20-10(8-22-11)14(15,16)17;/h8H,4-7,9H2,1-3H3,(H,18,19);1H |
| InChIKey | QYMOODJPMIZLON-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|