C14H28IN3O2S2 — CID 109490066
N',2,2-trimethyl-N-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109490066) has the molecular formula C14H28IN3O2S2 and a molecular weight of 461.44 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N',2,2-trimethyl-N-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490066 |
| Molecular Formula | C14H28IN3O2S2 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | N',2,2-trimethyl-N-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1(CS(C)(=O)=O)CC1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C14H27N3O2S2.HI/c1-13(2)10-17(7-8-20-13)12(15-3)16-9-14(5-6-14)11-21(4,18)19;/h5-11H2,1-4H3,(H,15,16);1H |
| InChIKey | OMNCQFYPYVQIAB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|