About N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide
N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 109490114) has the molecular formula C12H26IN3
and a molecular weight of 339.27 g/mol. Its IUPAC name is N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide |
| PubChem CID | 109490114 |
| Molecular Formula | C12H26IN3 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NC)C1.I |
| InChI | InChI=1S/C12H25N3.HI/c1-5-7-12(2)8-6-9-15(10-12)11(13-3)14-4;/h5-10H2,1-4H3,(H,13,14);1H |
| InChIKey | YOKLTRDKEKPSKJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide?
The IUPAC name of N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide (CID 109490114) is N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide.
What is the SMILES notation for N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide?
The canonical SMILES for N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide is CCCC1(C)CCCN(/C(=N/C)NC)C1.I.
What is the InChIKey of N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide?
The InChIKey is YOKLTRDKEKPSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3.HI/c1-5-7-12(2)8-6-9-15(10-12)11(13-3)14-4;/h5-10H2,1-4H3,(H,13,14);1H.
What are the key properties of N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide?
N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide has a molecular weight of 339.27 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N',3-trimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide is sourced from PubChem (CID 109490114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).