C23H24N4O2 — CID 10949114
1-benzyl-3-(cyclohexylmethyl)purino[7,8-a]pyridine-2,4-dione (PubChem CID 10949114) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-benzyl-3-(cyclohexylmethyl)purino[7,8-a]pyridine-2,4-dione.
| Compound Name | 1-benzyl-3-(cyclohexylmethyl)purino[7,8-a]pyridine-2,4-dione |
|---|---|
| PubChem CID | 10949114 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-benzyl-3-(cyclohexylmethyl)purino[7,8-a]pyridine-2,4-dione |
| SMILES | O=c1c2c(nc3ccccn32)n(Cc2ccccc2)c(=O)n1CC1CCCCC1 |
| InChI | InChI=1S/C23H24N4O2/c28-22-20-21(24-19-13-7-8-14-25(19)20)26(15-17-9-3-1-4-10-17)23(29)27(22)16-18-11-5-2-6-12-18/h1,3-4,7-10,13-14,18H,2,5-6,11-12,15-16H2 |
| InChIKey | FTEIUMZWLUBTGL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |