C22H40N4O2 — CID 109491995
1-[4-(diethylamino)butyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine (PubChem CID 109491995) has the molecular formula C22H40N4O2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-[4-(diethylamino)butyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine.
| Compound Name | 1-[4-(diethylamino)butyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109491995 |
| Molecular Formula | C22H40N4O2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 1-[4-(diethylamino)butyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC(C)C)c1)NCCCCN(CC)CC |
| InChI | InChI=1S/C22H40N4O2/c1-6-23-22(24-14-9-10-15-26(7-2)8-3)25-17-21(27)19-12-11-13-20(16-19)28-18(4)5/h11-13,16,18,21,27H,6-10,14-15,17H2,1-5H3,(H2,23,24,25) |
| InChIKey | CSXUNEMJXLBYCN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|