C16H28O7P2 — CID 10949255
[(2Z,6E)-3-ethenyl-7,11-dimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate (PubChem CID 10949255) has the molecular formula C16H28O7P2 and a molecular weight of 394.34 g/mol. Its IUPAC name is [(2Z,6E)-3-ethenyl-7,11-dimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate.
| Compound Name | [(2Z,6E)-3-ethenyl-7,11-dimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10949255 |
| Molecular Formula | C16H28O7P2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [(2Z,6E)-3-ethenyl-7,11-dimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
| SMILES | C=C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H28O7P2/c1-5-16(11-7-10-15(4)9-6-8-14(2)3)12-13-22-25(20,21)23-24(17,18)19/h5,8,10,12H,1,6-7,9,11,13H2,2-4H3,(H,20,21)(H2,17,18,19)/b15-10+,16-12+ |
| InChIKey | VLCGYUMYXVRSKX-NCZFFCEISA-N |
| XLogP | 4.80 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|