C20H30O8 — CID 10949344
(1R,2S,3S,5R,6R,7S,8S,9S,12S,13R)-2,6,7,9,13-pentahydroxy-3,8,12-trimethyl-5-propan-2-yl-4,14-dioxapentacyclo[6.5.3.01,9.02,7.03,5]hexadecan-15-one (PubChem CID 10949344) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is (1R,2S,3S,5R,6R,7S,8S,9S,12S,13R)-2,6,7,9,13-pentahydroxy-3,8,12-trimethyl-5-propan-2-yl-4,14-dioxapentacyclo[6.5.3.01,9.02,7.03,5]hexadecan-15-one.
| Compound Name | (1R,2S,3S,5R,6R,7S,8S,9S,12S,13R)-2,6,7,9,13-pentahydroxy-3,8,12-trimethyl-5-propan-2-yl-4,14-dioxapentacyclo[6.5.3.01,9.02,7.03,5]hexadecan-15-one |
|---|---|
| PubChem CID | 10949344 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (1R,2S,3S,5R,6R,7S,8S,9S,12S,13R)-2,6,7,9,13-pentahydroxy-3,8,12-trimethyl-5-propan-2-yl-4,14-dioxapentacyclo[6.5.3.01,9.02,7.03,5]hexadecan-15-one |
| SMILES | CC(C)[C@]12O[C@@]1(C)[C@@]1(O)[C@@](O)([C@H]2O)[C@@]2(C)CC(=O)O[C@@]13[C@H](O)[C@@H](C)CC[C@]23O |
| InChI | InChI=1S/C20H30O8/c1-9(2)17-13(23)18(25)14(4)8-11(21)27-19(20(18,26)15(17,5)28-17)12(22)10(3)6-7-16(14,19)24/h9-10,12-13,22-26H,6-8H2,1-5H3/t10-,12+,13-,14-,15+,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | AWUWXDWDCQRILN-IRNKUAGOSA-N |
| XLogP | -0.77 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|