C16H22N2O10 — CID 10949431
[(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-2-nitroethenyl]oxan-2-yl]methyl acetate (PubChem CID 10949431) has the molecular formula C16H22N2O10 and a molecular weight of 402.36 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-2-nitroethenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-2-nitroethenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10949431 |
| Molecular Formula | C16H22N2O10 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-2-nitroethenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N2O10/c1-8(19)17-14-12(5-6-18(23)24)28-13(7-25-9(2)20)15(26-10(3)21)16(14)27-11(4)22/h5-6,12-16H,7H2,1-4H3,(H,17,19)/b6-5+/t12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | URKBGZSLCUBNHB-PZXFSBAJSA-N |
| XLogP | -0.52 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|