C26H30N2O2 — CID 10949445
6-hydroxy-2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one (PubChem CID 10949445) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 6-hydroxy-2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one.
| Compound Name | 6-hydroxy-2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
|---|---|
| PubChem CID | 10949445 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 6-hydroxy-2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
| SMILES | O=C1Nc2ccc(O)c3c2C1(CCCCN1CC=C(c2ccccc2)CC1)CCC3 |
| InChI | InChI=1S/C26H30N2O2/c29-23-11-10-22-24-21(23)9-6-15-26(24,25(30)27-22)14-4-5-16-28-17-12-20(13-18-28)19-7-2-1-3-8-19/h1-3,7-8,10-12,29H,4-6,9,13-18H2,(H,27,30) |
| InChIKey | NPUZNBQJTXDJJT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|