About 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide
1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide (PubChem CID 109495986) has the molecular formula C13H28IN3
and a molecular weight of 353.29 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide |
| PubChem CID | 109495986 |
| Molecular Formula | C13H28IN3 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/C)NCCCCC.I |
| InChI | InChI=1S/C13H27N3.HI/c1-5-7-9-11-15-13(14-3)16(4)12-10-8-6-2;/h6H,2,5,7-12H2,1,3-4H3,(H,14,15);1H |
| InChIKey | RWLBABTZGQYWMV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide?
The IUPAC name of 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide (CID 109495986) is 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide.
What is the SMILES notation for 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide?
The canonical SMILES for 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide is C=CCCCN(C)/C(=N/C)NCCCCC.I.
What is the InChIKey of 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide?
The InChIKey is RWLBABTZGQYWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3.HI/c1-5-7-9-11-15-13(14-3)16(4)12-10-8-6-2;/h6H,2,5,7-12H2,1,3-4H3,(H,14,15);1H.
What are the key properties of 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide?
1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide has a molecular weight of 353.29 g/mol, XLogP of 3.27, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-1-pent-4-enyl-3-pentylguanidine;hydroiodide is sourced from PubChem (CID 109495986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).