C20H30O7Si — CID 10949629
methyl (4'aS,5'R,8'aR)-5'-[tert-butyl(dimethyl)silyl]oxy-4',8'-dioxospiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate (PubChem CID 10949629) has the molecular formula C20H30O7Si and a molecular weight of 410.54 g/mol. Its IUPAC name is methyl (4'aS,5'R,8'aR)-5'-[tert-butyl(dimethyl)silyl]oxy-4',8'-dioxospiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate.
| Compound Name | methyl (4'aS,5'R,8'aR)-5'-[tert-butyl(dimethyl)silyl]oxy-4',8'-dioxospiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate |
|---|---|
| PubChem CID | 10949629 |
| Molecular Formula | C20H30O7Si |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | methyl (4'aS,5'R,8'aR)-5'-[tert-butyl(dimethyl)silyl]oxy-4',8'-dioxospiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CCC3(OCCO3)[C@H]1C(=O)C=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H30O7Si/c1-18(2,3)28(5,6)27-15-8-7-13(21)16-19(25-11-12-26-19)10-9-14(22)20(15,16)17(23)24-4/h7-8,15-16H,9-12H2,1-6H3/t15-,16-,20-/m1/s1 |
| InChIKey | BDCQQXMINFGQOS-JXXFODFXSA-N |
| XLogP | 2.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|