About 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine
3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109496522) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine.
Molecular Properties
| Compound Name | 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine |
| PubChem CID | 109496522 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCCOC |
| InChI | InChI=1S/C11H23N3O/c1-5-6-7-9-14(3)11(12-2)13-8-10-15-4/h5H,1,6-10H2,2-4H3,(H,12,13) |
| InChIKey | SAQXMEUVKJNXLO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine?
The IUPAC name of 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine (CID 109496522) is 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine.
What is the SMILES notation for 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine?
The canonical SMILES for 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine is C=CCCCN(C)/C(=N/C)NCCOC.
What is the InChIKey of 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine?
The InChIKey is SAQXMEUVKJNXLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-5-6-7-9-14(3)11(12-2)13-8-10-15-4/h5H,1,6-10H2,2-4H3,(H,12,13).
What are the key properties of 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine?
3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine has a molecular weight of 213.32 g/mol, XLogP of 1.11, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyethyl)-1,2-dimethyl-1-pent-4-enylguanidine is sourced from PubChem (CID 109496522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).