C13H23F3N4O — CID 109496758
2-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 109496758) has the molecular formula C13H23F3N4O and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 109496758 |
| Molecular Formula | C13H23F3N4O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C=CCCCN(C)/C(=N/C)NCC(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C13H23F3N4O/c1-5-6-7-8-19(3)12(17-2)18-9-11(21)20(4)10-13(14,15)16/h5H,1,6-10H2,2-4H3,(H,17,18) |
| InChIKey | MXXZAIPFACARLS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|