C22H40O5Si — CID 10949682
1-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]non-2-ynyl formate (PubChem CID 10949682) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is 1-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]non-2-ynyl formate.
| Compound Name | 1-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]non-2-ynyl formate |
|---|---|
| PubChem CID | 10949682 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]non-2-ynyl formate |
| SMILES | CCCCCCC#CC(OC=O)[C@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O5Si/c1-9-10-11-12-13-14-15-18(24-17-23)20-19(26-22(5,6)27-20)16-25-28(7,8)21(2,3)4/h17-20H,9-13,16H2,1-8H3/t18?,19-,20+/m0/s1 |
| InChIKey | KSBWNEFTOQIHNE-NRRUETGQSA-N |
| XLogP | 5.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|