C19H31N3O — CID 109497041
1,2-dimethyl-1-pent-4-enyl-3-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine (PubChem CID 109497041) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109497041 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1cccc(COC(C)C)c1 |
| InChI | InChI=1S/C19H31N3O/c1-6-7-8-12-22(5)19(20-4)21-14-17-10-9-11-18(13-17)15-23-16(2)3/h6,9-11,13,16H,1,7-8,12,14-15H2,2-5H3,(H,20,21) |
| InChIKey | ZMYALFSVYGDIIQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|