C19H17Cl2NO4S — CID 10949959
6-chloro-5-(2-chloroacetyl)-3-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 10949959) has the molecular formula C19H17Cl2NO4S and a molecular weight of 426.32 g/mol. Its IUPAC name is 6-chloro-5-(2-chloroacetyl)-3-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one.
| Compound Name | 6-chloro-5-(2-chloroacetyl)-3-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 10949959 |
| Molecular Formula | C19H17Cl2NO4S |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 6-chloro-5-(2-chloroacetyl)-3-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | COc1ccc(C2Sc3cccc(Cl)c3N(C(=O)CCl)C(=O)C2OC)cc1 |
| InChI | InChI=1S/C19H17Cl2NO4S/c1-25-12-8-6-11(7-9-12)18-17(26-2)19(24)22(15(23)10-20)16-13(21)4-3-5-14(16)27-18/h3-9,17-18H,10H2,1-2H3 |
| InChIKey | JTUKWOPBZKEXOK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|