C27H39NO2Si — CID 10950198
[(1S)-1-[(2R,3aS)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 10950198) has the molecular formula C27H39NO2Si and a molecular weight of 437.70 g/mol. Its IUPAC name is [(1S)-1-[(2R,3aS)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(1S)-1-[(2R,3aS)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10950198 |
| Molecular Formula | C27H39NO2Si |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [(1S)-1-[(2R,3aS)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1C[C@@H]2CCCCN2O1 |
| InChI | InChI=1S/C27H39NO2Si/c1-21(2)26(25-20-22-14-12-13-19-28(22)29-25)30-31(27(3,4)5,23-15-8-6-9-16-23)24-17-10-7-11-18-24/h6-11,15-18,21-22,25-26H,12-14,19-20H2,1-5H3/t22-,25+,26-/m0/s1 |
| InChIKey | SCUKYHLCQQXUKV-DFCKQENNSA-N |
| XLogP | 5.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|