About 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine
4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine (PubChem CID 1095028) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine.
Molecular Properties
| Compound Name | 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine |
| PubChem CID | 1095028 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine |
| SMILES | Nc1ccc(N2CCCCC2)c2nonc12 |
| InChI | InChI=1S/C11H14N4O/c12-8-4-5-9(11-10(8)13-16-14-11)15-6-2-1-3-7-15/h4-5H,1-3,6-7,12H2 |
| InChIKey | LTNPOSGMLWWFOH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine?
The IUPAC name of 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine (CID 1095028) is 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine.
What is the SMILES notation for 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine?
The canonical SMILES for 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine is Nc1ccc(N2CCCCC2)c2nonc12.
What is the InChIKey of 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine?
The InChIKey is LTNPOSGMLWWFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c12-8-4-5-9(11-10(8)13-16-14-11)15-6-2-1-3-7-15/h4-5H,1-3,6-7,12H2.
What are the key properties of 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine?
4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine has a molecular weight of 218.26 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-1-yl-2,1,3-benzoxadiazol-7-amine is sourced from PubChem (CID 1095028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).