C24H28N6O3 — CID 10950399
16-[2-(dimethylamino)ethyl]-10-[3-(dimethylamino)propyl]-5-hydroxy-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2(7),3,5,8,11(19),12,14(18)-heptaene-15,17-dione (PubChem CID 10950399) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 16-[2-(dimethylamino)ethyl]-10-[3-(dimethylamino)propyl]-5-hydroxy-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2(7),3,5,8,11(19),12,14(18)-heptaene-15,17-dione.
| Compound Name | 16-[2-(dimethylamino)ethyl]-10-[3-(dimethylamino)propyl]-5-hydroxy-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2(7),3,5,8,11(19),12,14(18)-heptaene-15,17-dione |
|---|---|
| PubChem CID | 10950399 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 16-[2-(dimethylamino)ethyl]-10-[3-(dimethylamino)propyl]-5-hydroxy-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2(7),3,5,8,11(19),12,14(18)-heptaene-15,17-dione |
| SMILES | CN(C)CCCn1nc2c3cc(O)ccc3n3c(=O)n(CCN(C)C)c(=O)c4ccc1c2c43 |
| InChI | InChI=1S/C24H28N6O3/c1-26(2)10-5-11-29-19-9-7-16-22-20(19)21(25-29)17-14-15(31)6-8-18(17)30(22)24(33)28(23(16)32)13-12-27(3)4/h6-9,14,31H,5,10-13H2,1-4H3 |
| InChIKey | GPTVMIOMIJTIPF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|