C25H38O7 — CID 10950432
methyl (2R,3S,3aR,5aS,7R,8aR,8bS)-3-ethenyl-7-[(2R,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-2-carboxylate (PubChem CID 10950432) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is methyl (2R,3S,3aR,5aS,7R,8aR,8bS)-3-ethenyl-7-[(2R,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-2-carboxylate.
| Compound Name | methyl (2R,3S,3aR,5aS,7R,8aR,8bS)-3-ethenyl-7-[(2R,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-2-carboxylate |
|---|---|
| PubChem CID | 10950432 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | methyl (2R,3S,3aR,5aS,7R,8aR,8bS)-3-ethenyl-7-[(2R,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-2-carboxylate |
| SMILES | C=C[C@H]1[C@@H]2C=C[C@@H]3C[C@@H](O[C@@H]4O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]4OC)C[C@H]3[C@@H]2C[C@H]1C(=O)OC |
| InChI | InChI=1S/C25H38O7/c1-7-16-17-9-8-14-10-15(11-18(14)19(17)12-20(16)24(26)30-6)32-25-23(29-5)22(28-4)21(27-3)13(2)31-25/h7-9,13-23,25H,1,10-12H2,2-6H3/t13-,14+,15+,16-,17-,18+,19+,20+,21-,22+,23+,25-/m0/s1 |
| InChIKey | JDEKEGDHKTZJRU-JNLAVEDXSA-N |
| XLogP | 2.98 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|