About 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide
4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide (PubChem CID 1095045) has the molecular formula C18H18BrN3O
and a molecular weight of 372.27 g/mol. Its IUPAC name is 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide.
Molecular Properties
| Compound Name | 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide |
| PubChem CID | 1095045 |
| Molecular Formula | C18H18BrN3O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide |
| SMILES | CC1(C)Cc2ccccc2C(NNC(=O)c2ccc(Br)cc2)=N1 |
| InChI | InChI=1S/C18H18BrN3O/c1-18(2)11-13-5-3-4-6-15(13)16(20-18)21-22-17(23)12-7-9-14(19)10-8-12/h3-10H,11H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | GNPIQXJDIYVXEY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide?
The IUPAC name of 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide (CID 1095045) is 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide.
What is the SMILES notation for 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide?
The canonical SMILES for 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide is CC1(C)Cc2ccccc2C(NNC(=O)c2ccc(Br)cc2)=N1.
What is the InChIKey of 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide?
The InChIKey is GNPIQXJDIYVXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrN3O/c1-18(2)11-13-5-3-4-6-15(13)16(20-18)21-22-17(23)12-7-9-14(19)10-8-12/h3-10H,11H2,1-2H3,(H,20,21)(H,22,23).
What are the key properties of 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide?
4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide has a molecular weight of 372.27 g/mol, XLogP of 3.46, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N'-(3,3-dimethyl-4H-isoquinolin-1-yl)benzohydrazide is sourced from PubChem (CID 1095045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).