C25H41NO4S — CID 10950453
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate (PubChem CID 10950453) has the molecular formula C25H41NO4S and a molecular weight of 451.67 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
|---|---|
| PubChem CID | 10950453 |
| Molecular Formula | C25H41NO4S |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C |
| InChI | InChI=1S/C25H41NO4S/c1-4-23(27)30-22-17-19-15-16-25(22,24(19,2)3)18-31(28,29)26(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h4,19-22H,1,5-18H2,2-3H3/t19-,22-,25-/m1/s1 |
| InChIKey | RLCIVQZPBIFRIK-OPJGWUQDSA-N |
| XLogP | 5.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|