C23H36O9 — CID 10950544
[(E)-4-(2,2-dimethylpropanoyloxy)-3-[(1S,2S,6S,7S,9R)-9-(hydroxymethyl)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-6-yl]but-2-enyl] 2,2-dimethylpropanoate (PubChem CID 10950544) has the molecular formula C23H36O9 and a molecular weight of 456.53 g/mol. Its IUPAC name is [(E)-4-(2,2-dimethylpropanoyloxy)-3-[(1S,2S,6S,7S,9R)-9-(hydroxymethyl)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-6-yl]but-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-4-(2,2-dimethylpropanoyloxy)-3-[(1S,2S,6S,7S,9R)-9-(hydroxymethyl)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-6-yl]but-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10950544 |
| Molecular Formula | C23H36O9 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | [(E)-4-(2,2-dimethylpropanoyloxy)-3-[(1S,2S,6S,7S,9R)-9-(hydroxymethyl)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-6-yl]but-2-enyl] 2,2-dimethylpropanoate |
| SMILES | CC1(C)O[C@H]2[C@H]3O[C@H](O[C@@H]3CO)[C@@]2(/C(=C/COC(=O)C(C)(C)C)COC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H36O9/c1-20(2,3)17(25)27-10-9-13(12-28-18(26)21(4,5)6)23-16(31-22(7,8)32-23)15-14(11-24)29-19(23)30-15/h9,14-16,19,24H,10-12H2,1-8H3/b13-9+/t14-,15+,16+,19+,23+/m1/s1 |
| InChIKey | WIWRDPSXRNJTJF-QSZRWXCZSA-N |
| XLogP | 2.10 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|