C23H23N3O2 — CID 1095055
2-N,6-N-bis(2-phenylethyl)pyridine-2,6-dicarboxamide (PubChem CID 1095055) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-N,6-N-bis(2-phenylethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(2-phenylethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 1095055 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-N,6-N-bis(2-phenylethyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cccc(C(=O)NCCc2ccccc2)n1 |
| InChI | InChI=1S/C23H23N3O2/c27-22(24-16-14-18-8-3-1-4-9-18)20-12-7-13-21(26-20)23(28)25-17-15-19-10-5-2-6-11-19/h1-13H,14-17H2,(H,24,27)(H,25,28) |
| InChIKey | XAVSESQGFAJPCJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |