C30H50O3 — CID 10950586
(2Z)-2-[(2S,3R,4R)-2-(3-hydroxypropyl)-3-[(3E,6R,7E)-6-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dimethylcyclohexylidene]propanal (PubChem CID 10950586) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is (2Z)-2-[(2S,3R,4R)-2-(3-hydroxypropyl)-3-[(3E,6R,7E)-6-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dimethylcyclohexylidene]propanal.
| Compound Name | (2Z)-2-[(2S,3R,4R)-2-(3-hydroxypropyl)-3-[(3E,6R,7E)-6-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dimethylcyclohexylidene]propanal |
|---|---|
| PubChem CID | 10950586 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | (2Z)-2-[(2S,3R,4R)-2-(3-hydroxypropyl)-3-[(3E,6R,7E)-6-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dimethylcyclohexylidene]propanal |
| SMILES | CC(C)=CCC/C(C)=C/[C@H](O)C/C(C)=C/CC[C@]1(C)[C@H](C)CC/C(=C(\C)C=O)[C@H]1CCCO |
| InChI | InChI=1S/C30H50O3/c1-22(2)11-8-12-23(3)19-27(33)20-24(4)13-9-17-30(7)26(6)15-16-28(25(5)21-32)29(30)14-10-18-31/h11,13,19,21,26-27,29,31,33H,8-10,12,14-18,20H2,1-7H3/b23-19+,24-13+,28-25-/t26-,27+,29-,30-/m1/s1 |
| InChIKey | KGNYOYQNEUDLHE-ZJZAYCHTSA-N |
| XLogP | 7.50 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|