C15H13Cl4NO7 — CID 10950617
4,5,6,7-tetrachloro-2-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]isoindole-1,3-dione (PubChem CID 10950617) has the molecular formula C15H13Cl4NO7 and a molecular weight of 461.08 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10950617 |
| Molecular Formula | C15H13Cl4NO7 |
| Molecular Weight | 461.08 g/mol |
| Exact Mass | 458.94 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]isoindole-1,3-dione |
| SMILES | CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C15H13Cl4NO7/c1-26-15-10(12(23)11(22)3(2-21)27-15)20-13(24)4-5(14(20)25)7(17)9(19)8(18)6(4)16/h3,10-12,15,21-23H,2H2,1H3/t3-,10-,11-,12-,15-/m1/s1 |
| InChIKey | PUSVBHJQUZNFIW-YPLZTNBCSA-N |
| XLogP | 1.35 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.08 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|