C22H42O8Si — CID 10950644
[(4R,4aR,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-4-yl]methyl acetate (PubChem CID 10950644) has the molecular formula C22H42O8Si and a molecular weight of 462.66 g/mol. Its IUPAC name is [(4R,4aR,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-4-yl]methyl acetate.
| Compound Name | [(4R,4aR,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-4-yl]methyl acetate |
|---|---|
| PubChem CID | 10950644 |
| Molecular Formula | C22H42O8Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(4R,4aR,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-4-yl]methyl acetate |
| SMILES | CO[C@@H]1[C@H]2OCO[C@H](COC(C)=O)[C@H]2O[C@H](C[C@H](O)CO[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C22H42O8Si/c1-14(23)26-12-16-18-19(28-13-27-16)20(25-7)22(5,6)17(30-18)10-15(24)11-29-31(8,9)21(2,3)4/h15-20,24H,10-13H2,1-9H3/t15-,16+,17+,18+,19-,20+/m0/s1 |
| InChIKey | MRQJVKFWMDZCGW-GPBSYSOESA-N |
| XLogP | 2.87 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|