C26H44N2O3S — CID 10950692
N-[(11S)-11-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]pentadecyl]benzenesulfonamide (PubChem CID 10950692) has the molecular formula C26H44N2O3S and a molecular weight of 464.72 g/mol. Its IUPAC name is N-[(11S)-11-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]pentadecyl]benzenesulfonamide.
| Compound Name | N-[(11S)-11-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]pentadecyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10950692 |
| Molecular Formula | C26H44N2O3S |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | N-[(11S)-11-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]pentadecyl]benzenesulfonamide |
| SMILES | CCCCC(CCCCCCCCCCNS(=O)(=O)c1ccccc1)C1=N[C@H](CC)CO1 |
| InChI | InChI=1S/C26H44N2O3S/c1-3-5-17-23(26-28-24(4-2)22-31-26)18-13-10-8-6-7-9-11-16-21-27-32(29,30)25-19-14-12-15-20-25/h12,14-15,19-20,23-24,27H,3-11,13,16-18,21-22H2,1-2H3/t23?,24-/m1/s1 |
| InChIKey | HTFDYTAZHSVLST-XMMISQBUSA-N |
| XLogP | 6.49 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|