C26H35NO5S — CID 10950832
2-(3,4-dimethoxyphenyl)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-prop-2-enylpent-4-en-1-one (PubChem CID 10950832) has the molecular formula C26H35NO5S and a molecular weight of 473.64 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-prop-2-enylpent-4-en-1-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-prop-2-enylpent-4-en-1-one |
|---|---|
| PubChem CID | 10950832 |
| Molecular Formula | C26H35NO5S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-prop-2-enylpent-4-en-1-one |
| SMILES | C=CCC(CC=C)(C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H35NO5S/c1-7-12-25(13-8-2,19-9-10-20(31-5)21(15-19)32-6)23(28)27-22-16-18-11-14-26(22,24(18,3)4)17-33(27,29)30/h7-10,15,18,22H,1-2,11-14,16-17H2,3-6H3/t18-,22-,26-/m1/s1 |
| InChIKey | DPMQWCOTUZVKEB-NDKUEENFSA-N |
| XLogP | 4.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|