About [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate
[(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate (PubChem CID 10950863) has the molecular formula C30H34FNO3
and a molecular weight of 475.60 g/mol. Its IUPAC name is [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate.
Molecular Properties
| Compound Name | [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate |
| PubChem CID | 10950863 |
| Molecular Formula | C30H34FNO3 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1CN(Cc2ccc(F)cc2)CC[C@H]1CCOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34FNO3/c1-2-29(33)35-28-22-32(21-23-13-15-27(31)16-14-23)19-17-24(28)18-20-34-30(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-16,24,28,30H,2,17-22H2,1H3/t24-,28+/m0/s1 |
| InChIKey | HAUSKZCLZIFMCQ-RBJSKKJNSA-N |
| XLogP | 6.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate?
The IUPAC name of [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate (CID 10950863) is [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate.
What is the SMILES notation for [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate?
The canonical SMILES for [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate is CCC(=O)O[C@@H]1CN(Cc2ccc(F)cc2)CC[C@H]1CCOC(c1ccccc1)c1ccccc1.
What is the InChIKey of [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate?
The InChIKey is HAUSKZCLZIFMCQ-RBJSKKJNSA-N. The full InChI is InChI=1S/C30H34FNO3/c1-2-29(33)35-28-22-32(21-23-13-15-27(31)16-14-23)19-17-24(28)18-20-34-30(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-16,24,28,30H,2,17-22H2,1H3/t24-,28+/m0/s1.
What are the key properties of [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate?
[(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate has a molecular weight of 475.60 g/mol, XLogP of 6.17, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-yl] propanoate is sourced from PubChem (CID 10950863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).