About 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone
4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone (PubChem CID 10950948) has the molecular formula C11H16O2S2Se3
and a molecular weight of 481.26 g/mol. Its IUPAC name is 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone.
Molecular Properties
| Compound Name | 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone |
| PubChem CID | 10950948 |
| Molecular Formula | C11H16O2S2Se3 |
| Molecular Weight | 481.26 g/mol |
| Exact Mass | 483.81 |
| IUPAC Name | 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone |
| SMILES | CSc1[se]c(=[Se])[se]c1SCCOC1CCCCO1 |
| InChI | InChI=1S/C11H16O2S2Se3/c1-14-9-10(18-11(16)17-9)15-7-6-13-8-4-2-3-5-12-8/h8H,2-7H2,1H3 |
| InChIKey | QEPZOPHZFZVSMW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone?
The IUPAC name of 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone (CID 10950948) is 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone.
What is the SMILES notation for 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone?
The canonical SMILES for 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone is CSc1[se]c(=[Se])[se]c1SCCOC1CCCCO1.
What is the InChIKey of 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone?
The InChIKey is QEPZOPHZFZVSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2S2Se3/c1-14-9-10(18-11(16)17-9)15-7-6-13-8-4-2-3-5-12-8/h8H,2-7H2,1H3.
What are the key properties of 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone?
4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone has a molecular weight of 481.26 g/mol, XLogP of 1.86, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-diselenole-2-selone is sourced from PubChem (CID 10950948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).