C24H21N3O — CID 1095096
2,4-bis(4-methylphenyl)-6-phenylmethoxy-1,3,5-triazine (PubChem CID 1095096) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 2,4-bis(4-methylphenyl)-6-phenylmethoxy-1,3,5-triazine.
| Compound Name | 2,4-bis(4-methylphenyl)-6-phenylmethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 1095096 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2,4-bis(4-methylphenyl)-6-phenylmethoxy-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(OCc3ccccc3)nc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C24H21N3O/c1-17-8-12-20(13-9-17)22-25-23(21-14-10-18(2)11-15-21)27-24(26-22)28-16-19-6-4-3-5-7-19/h3-15H,16H2,1-2H3 |
| InChIKey | FJXQKXMIOILHNG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |