aniline;sulfuric acid

C12H16N2O4S — CID 10951

IUPACaniline;sulfuric acid
SMILESNc1ccccc1.Nc1ccccc1.O=S(=O)(O)O
InChIInChI=1S/2C6H7N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5H,7H2;(H2,1,2,3,4)
InChIKeyFUKMEFZGEMVGLD-UHFFFAOYSA-N
MW284.34 g/mol
LogP1.88
Rot. Bonds

About aniline;sulfuric acid

aniline;sulfuric acid (PubChem CID 10951) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is aniline;sulfuric acid.

Molecular Properties

Compound Nameaniline;sulfuric acid
PubChem CID10951
Molecular FormulaC12H16N2O4S
Molecular Weight284.34 g/mol
Exact Mass284.08
IUPAC Nameaniline;sulfuric acid
SMILESNc1ccccc1.Nc1ccccc1.O=S(=O)(O)O
InChIInChI=1S/2C6H7N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5H,7H2;(H2,1,2,3,4)
InChIKeyFUKMEFZGEMVGLD-UHFFFAOYSA-N
XLogP1.88
TPSA126.64 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.34
LogP ≤ 51.88
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze aniline;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of aniline;sulfuric acid?
The IUPAC name of aniline;sulfuric acid (CID 10951) is aniline;sulfuric acid.
What is the SMILES notation for aniline;sulfuric acid?
The canonical SMILES for aniline;sulfuric acid is Nc1ccccc1.Nc1ccccc1.O=S(=O)(O)O.
What is the InChIKey of aniline;sulfuric acid?
The InChIKey is FUKMEFZGEMVGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5H,7H2;(H2,1,2,3,4).
What are the key properties of aniline;sulfuric acid?
aniline;sulfuric acid has a molecular weight of 284.34 g/mol, XLogP of 1.88, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;sulfuric acid is sourced from PubChem (CID 10951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).