About aniline;sulfuric acid
aniline;sulfuric acid (PubChem CID 10951) has the molecular formula C12H16N2O4S
and a molecular weight of 284.34 g/mol. Its IUPAC name is aniline;sulfuric acid.
Molecular Properties
| Compound Name | aniline;sulfuric acid |
| PubChem CID | 10951 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | aniline;sulfuric acid |
| SMILES | Nc1ccccc1.Nc1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C6H7N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5H,7H2;(H2,1,2,3,4) |
| InChIKey | FUKMEFZGEMVGLD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze aniline;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;sulfuric acid?
The IUPAC name of aniline;sulfuric acid (CID 10951) is aniline;sulfuric acid.
What is the SMILES notation for aniline;sulfuric acid?
The canonical SMILES for aniline;sulfuric acid is Nc1ccccc1.Nc1ccccc1.O=S(=O)(O)O.
What is the InChIKey of aniline;sulfuric acid?
The InChIKey is FUKMEFZGEMVGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5H,7H2;(H2,1,2,3,4).
What are the key properties of aniline;sulfuric acid?
aniline;sulfuric acid has a molecular weight of 284.34 g/mol, XLogP of 1.88, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;sulfuric acid is sourced from PubChem (CID 10951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).