C30H35NO4Si — CID 10951212
(4S)-3-benzyl-4-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-1,3-oxazolidine-2,5-dione (PubChem CID 10951212) has the molecular formula C30H35NO4Si and a molecular weight of 501.70 g/mol. Its IUPAC name is (4S)-3-benzyl-4-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-1,3-oxazolidine-2,5-dione.
| Compound Name | (4S)-3-benzyl-4-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 10951212 |
| Molecular Formula | C30H35NO4Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (4S)-3-benzyl-4-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-1,3-oxazolidine-2,5-dione |
| SMILES | CC(C)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1C(=O)OC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H35NO4Si/c1-22(2)27(26-28(32)34-29(33)31(26)21-23-15-9-6-10-16-23)35-36(30(3,4)5,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,22,26-27H,21H2,1-5H3/t26-,27+/m0/s1 |
| InChIKey | BZTIAESVHCXFPZ-RRPNLBNLSA-N |
| XLogP | 5.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|