C22H26O14 — CID 10951364
[(2R,3R,4S,5R,6R)-6-[[(3aS,4R,7aS)-1,3,6-trioxo-4,5,7,7a-tetrahydro-3aH-2-benzofuran-4-yl]oxy]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 10951364) has the molecular formula C22H26O14 and a molecular weight of 514.44 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[[(3aS,4R,7aS)-1,3,6-trioxo-4,5,7,7a-tetrahydro-3aH-2-benzofuran-4-yl]oxy]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[[(3aS,4R,7aS)-1,3,6-trioxo-4,5,7,7a-tetrahydro-3aH-2-benzofuran-4-yl]oxy]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10951364 |
| Molecular Formula | C22H26O14 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[[(3aS,4R,7aS)-1,3,6-trioxo-4,5,7,7a-tetrahydro-3aH-2-benzofuran-4-yl]oxy]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2CC(=O)C[C@@H]3C(=O)OC(=O)[C@@H]32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H26O14/c1-8(23)30-7-15-17(31-9(2)24)18(32-10(3)25)19(33-11(4)26)22(35-15)34-14-6-12(27)5-13-16(14)21(29)36-20(13)28/h13-19,22H,5-7H2,1-4H3/t13-,14+,15+,16-,17+,18-,19+,22+/m0/s1 |
| InChIKey | RGGULYRBFJGVDG-GQRQAWKGSA-N |
| XLogP | -0.87 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|